About 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal
2-(1,3-dioxolan-2-ylmethyl)prop-2-enal (PubChem CID 91619183) has the molecular formula C7H10O3
and a molecular weight of 142.15 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal.
Molecular Properties
| Compound Name | 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal |
| PubChem CID | 91619183 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal |
| SMILES | C=C(C=O)CC1OCCO1 |
| InChI | InChI=1S/C7H10O3/c1-6(5-8)4-7-9-2-3-10-7/h5,7H,1-4H2 |
| InChIKey | GGCYYXSNHGCWHB-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal?
The IUPAC name of 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal (CID 91619183) is 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal.
What is the SMILES notation for 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal?
The canonical SMILES for 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal is C=C(C=O)CC1OCCO1.
What is the InChIKey of 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal?
The InChIKey is GGCYYXSNHGCWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3/c1-6(5-8)4-7-9-2-3-10-7/h5,7H,1-4H2.
What are the key properties of 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal?
2-(1,3-dioxolan-2-ylmethyl)prop-2-enal has a molecular weight of 142.15 g/mol, XLogP of 0.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxolan-2-ylmethyl)prop-2-enal is sourced from PubChem (CID 91619183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).