About 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione
5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione (PubChem CID 91619204) has the molecular formula C8H11BrN2O4
and a molecular weight of 279.09 g/mol. Its IUPAC name is 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione |
| PubChem CID | 91619204 |
| Molecular Formula | C8H11BrN2O4 |
| Molecular Weight | 279.09 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione |
| SMILES | COCn1cc(Br)c(=O)n(COC)c1=O |
| InChI | InChI=1S/C8H11BrN2O4/c1-14-4-10-3-6(9)7(12)11(5-15-2)8(10)13/h3H,4-5H2,1-2H3 |
| InChIKey | SBCSZDSGBZENIN-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.09 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
The IUPAC name of 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione (CID 91619204) is 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
The canonical SMILES for 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione is COCn1cc(Br)c(=O)n(COC)c1=O.
What is the InChIKey of 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
The InChIKey is SBCSZDSGBZENIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrN2O4/c1-14-4-10-3-6(9)7(12)11(5-15-2)8(10)13/h3H,4-5H2,1-2H3.
What are the key properties of 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione?
5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione has a molecular weight of 279.09 g/mol, XLogP of -0.02, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3-bis(methoxymethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 91619204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).