About (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol
(1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol (PubChem CID 91619297) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol.
Molecular Properties
| Compound Name | (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol |
| PubChem CID | 91619297 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol |
| SMILES | O/N=C1/CCc2c(O)cccc21 |
| InChI | InChI=1S/C9H9NO2/c11-9-3-1-2-6-7(9)4-5-8(6)10-12/h1-3,11-12H,4-5H2/b10-8- |
| InChIKey | IQMLTLPOBWCRRE-NTMALXAHSA-N |
| XLogP | 1.52 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol?
The IUPAC name of (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol (CID 91619297) is (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol.
What is the SMILES notation for (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol?
The canonical SMILES for (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol is O/N=C1/CCc2c(O)cccc21.
What is the InChIKey of (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol?
The InChIKey is IQMLTLPOBWCRRE-NTMALXAHSA-N. The full InChI is InChI=1S/C9H9NO2/c11-9-3-1-2-6-7(9)4-5-8(6)10-12/h1-3,11-12H,4-5H2/b10-8-.
What are the key properties of (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol?
(1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol has a molecular weight of 163.18 g/mol, XLogP of 1.52, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-1-hydroxyimino-2,3-dihydroinden-4-ol is sourced from PubChem (CID 91619297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).