About 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol
1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol (PubChem CID 91619392) has the molecular formula C11H11BrN2OS
and a molecular weight of 299.19 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol |
| PubChem CID | 91619392 |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol |
| SMILES | [H]/N=c1\sccn1CC(O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H11BrN2OS/c12-9-3-1-2-8(6-9)10(15)7-14-4-5-16-11(14)13/h1-6,10,13,15H,7H2/b13-11- |
| InChIKey | IGKQBMAHKRJMEK-QBFSEMIESA-N |
| XLogP | 2.53 |
| TPSA | 49.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol?
The IUPAC name of 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol (CID 91619392) is 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol.
What is the SMILES notation for 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol?
The canonical SMILES for 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol is [H]/N=c1\sccn1CC(O)c1cccc(Br)c1.
What is the InChIKey of 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol?
The InChIKey is IGKQBMAHKRJMEK-QBFSEMIESA-N. The full InChI is InChI=1S/C11H11BrN2OS/c12-9-3-1-2-8(6-9)10(15)7-14-4-5-16-11(14)13/h1-6,10,13,15H,7H2/b13-11-.
What are the key properties of 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol?
1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol has a molecular weight of 299.19 g/mol, XLogP of 2.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromophenyl)-2-(2-imino-1,3-thiazol-3-yl)ethanol is sourced from PubChem (CID 91619392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).