About 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine
5-(2-fluoroethyl)-2,4-dimethoxypyrimidine (PubChem CID 91619481) has the molecular formula C8H11FN2O2
and a molecular weight of 186.19 g/mol. Its IUPAC name is 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine |
| PubChem CID | 91619481 |
| Molecular Formula | C8H11FN2O2 |
| Molecular Weight | 186.19 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine |
| SMILES | COc1ncc(CCF)c(OC)n1 |
| InChI | InChI=1S/C8H11FN2O2/c1-12-7-6(3-4-9)5-10-8(11-7)13-2/h5H,3-4H2,1-2H3 |
| InChIKey | VXFCXCMBYIBBIG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine?
The IUPAC name of 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine (CID 91619481) is 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine.
What is the SMILES notation for 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine?
The canonical SMILES for 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine is COc1ncc(CCF)c(OC)n1.
What is the InChIKey of 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine?
The InChIKey is VXFCXCMBYIBBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O2/c1-12-7-6(3-4-9)5-10-8(11-7)13-2/h5H,3-4H2,1-2H3.
What are the key properties of 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine?
5-(2-fluoroethyl)-2,4-dimethoxypyrimidine has a molecular weight of 186.19 g/mol, XLogP of 1.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-fluoroethyl)-2,4-dimethoxypyrimidine is sourced from PubChem (CID 91619481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).