About 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol
3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol (PubChem CID 91619655) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol |
| PubChem CID | 91619655 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol |
| SMILES | NCCC(O)N1COc2ccccc21 |
| InChI | InChI=1S/C10H14N2O2/c11-6-5-10(13)12-7-14-9-4-2-1-3-8(9)12/h1-4,10,13H,5-7,11H2 |
| InChIKey | CKVSYAKZPUJWTN-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol?
The IUPAC name of 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol (CID 91619655) is 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol.
What is the SMILES notation for 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol?
The canonical SMILES for 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol is NCCC(O)N1COc2ccccc21.
What is the InChIKey of 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol?
The InChIKey is CKVSYAKZPUJWTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c11-6-5-10(13)12-7-14-9-4-2-1-3-8(9)12/h1-4,10,13H,5-7,11H2.
What are the key properties of 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol?
3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol has a molecular weight of 194.23 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(2H-1,3-benzoxazol-3-yl)propan-1-ol is sourced from PubChem (CID 91619655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).