About S-ethyl 2-(1-benzofuran-3-yl)ethanethioate
S-ethyl 2-(1-benzofuran-3-yl)ethanethioate (PubChem CID 91620594) has the molecular formula C12H12O2S
and a molecular weight of 220.29 g/mol. Its IUPAC name is S-ethyl 2-(1-benzofuran-3-yl)ethanethioate.
Molecular Properties
| Compound Name | S-ethyl 2-(1-benzofuran-3-yl)ethanethioate |
| PubChem CID | 91620594 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | S-ethyl 2-(1-benzofuran-3-yl)ethanethioate |
| SMILES | CCSC(=O)Cc1coc2ccccc12 |
| InChI | InChI=1S/C12H12O2S/c1-2-15-12(13)7-9-8-14-11-6-4-3-5-10(9)11/h3-6,8H,2,7H2,1H3 |
| InChIKey | ACCPUUGBLWFLBL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl 2-(1-benzofuran-3-yl)ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl 2-(1-benzofuran-3-yl)ethanethioate?
The IUPAC name of S-ethyl 2-(1-benzofuran-3-yl)ethanethioate (CID 91620594) is S-ethyl 2-(1-benzofuran-3-yl)ethanethioate.
What is the SMILES notation for S-ethyl 2-(1-benzofuran-3-yl)ethanethioate?
The canonical SMILES for S-ethyl 2-(1-benzofuran-3-yl)ethanethioate is CCSC(=O)Cc1coc2ccccc12.
What is the InChIKey of S-ethyl 2-(1-benzofuran-3-yl)ethanethioate?
The InChIKey is ACCPUUGBLWFLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2S/c1-2-15-12(13)7-9-8-14-11-6-4-3-5-10(9)11/h3-6,8H,2,7H2,1H3.
What are the key properties of S-ethyl 2-(1-benzofuran-3-yl)ethanethioate?
S-ethyl 2-(1-benzofuran-3-yl)ethanethioate has a molecular weight of 220.29 g/mol, XLogP of 3.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl 2-(1-benzofuran-3-yl)ethanethioate is sourced from PubChem (CID 91620594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).