About 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile
3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile (PubChem CID 91620718) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile |
| PubChem CID | 91620718 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile |
| SMILES | CN1CC(CCC#N)OC1=O |
| InChI | InChI=1S/C7H10N2O2/c1-9-5-6(3-2-4-8)11-7(9)10/h6H,2-3,5H2,1H3 |
| InChIKey | GKSCACUCJRXMQS-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile?
The IUPAC name of 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile (CID 91620718) is 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile.
What is the SMILES notation for 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile?
The canonical SMILES for 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile is CN1CC(CCC#N)OC1=O.
What is the InChIKey of 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile?
The InChIKey is GKSCACUCJRXMQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-9-5-6(3-2-4-8)11-7(9)10/h6H,2-3,5H2,1H3.
What are the key properties of 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile?
3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile has a molecular weight of 154.17 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-methyl-2-oxo-1,3-oxazolidin-5-yl)propanenitrile is sourced from PubChem (CID 91620718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).