About 4H-pyrido[3,2-b][1,4]oxazine-3-thione
4H-pyrido[3,2-b][1,4]oxazine-3-thione (PubChem CID 91621570) has the molecular formula C7H6N2OS
and a molecular weight of 166.21 g/mol. Its IUPAC name is 4H-pyrido[3,2-b][1,4]oxazine-3-thione.
Molecular Properties
| Compound Name | 4H-pyrido[3,2-b][1,4]oxazine-3-thione |
| PubChem CID | 91621570 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 4H-pyrido[3,2-b][1,4]oxazine-3-thione |
| SMILES | S=C1COc2cccnc2N1 |
| InChI | InChI=1S/C7H6N2OS/c11-6-4-10-5-2-1-3-8-7(5)9-6/h1-3H,4H2,(H,8,9,11) |
| InChIKey | NSUYBBMXLYEZKS-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4H-pyrido[3,2-b][1,4]oxazine-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-pyrido[3,2-b][1,4]oxazine-3-thione?
The IUPAC name of 4H-pyrido[3,2-b][1,4]oxazine-3-thione (CID 91621570) is 4H-pyrido[3,2-b][1,4]oxazine-3-thione.
What is the SMILES notation for 4H-pyrido[3,2-b][1,4]oxazine-3-thione?
The canonical SMILES for 4H-pyrido[3,2-b][1,4]oxazine-3-thione is S=C1COc2cccnc2N1.
What is the InChIKey of 4H-pyrido[3,2-b][1,4]oxazine-3-thione?
The InChIKey is NSUYBBMXLYEZKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c11-6-4-10-5-2-1-3-8-7(5)9-6/h1-3H,4H2,(H,8,9,11).
What are the key properties of 4H-pyrido[3,2-b][1,4]oxazine-3-thione?
4H-pyrido[3,2-b][1,4]oxazine-3-thione has a molecular weight of 166.21 g/mol, XLogP of 1.21, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-pyrido[3,2-b][1,4]oxazine-3-thione is sourced from PubChem (CID 91621570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).