C9H18N2O2S2 — CID 91621820
1-thia-4-azaspiro[5.5]undecane-4-sulfonamide (PubChem CID 91621820) has the molecular formula C9H18N2O2S2 and a molecular weight of 250.39 g/mol. Its IUPAC name is 1-thia-4-azaspiro[5.5]undecane-4-sulfonamide.
| Compound Name | 1-thia-4-azaspiro[5.5]undecane-4-sulfonamide |
|---|---|
| PubChem CID | 91621820 |
| Molecular Formula | C9H18N2O2S2 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 1-thia-4-azaspiro[5.5]undecane-4-sulfonamide |
| SMILES | NS(=O)(=O)N1CCSC2(CCCCC2)C1 |
| InChI | InChI=1S/C9H18N2O2S2/c10-15(12,13)11-6-7-14-9(8-11)4-2-1-3-5-9/h1-8H2,(H2,10,12,13) |
| InChIKey | GLHUZVNPJAFXOR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |