About (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate
(2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate (PubChem CID 91622627) has the molecular formula C9H7N3O6
and a molecular weight of 253.17 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| PubChem CID | 91622627 |
| Molecular Formula | C9H7N3O6 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C9H7N3O6/c13-5-3-4(10-9(17)11-5)8(16)18-12-6(14)1-2-7(12)15/h3H,1-2H2,(H2,10,11,13,17) |
| InChIKey | VSLIXKCLVCVGMU-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate (CID 91622627) is (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate is O=C(ON1C(=O)CCC1=O)c1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate?
The InChIKey is VSLIXKCLVCVGMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3O6/c13-5-3-4(10-9(17)11-5)8(16)18-12-6(14)1-2-7(12)15/h3H,1-2H2,(H2,10,11,13,17).
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate?
(2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate has a molecular weight of 253.17 g/mol, XLogP of -1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 2,4-dioxo-1H-pyrimidine-6-carboxylate is sourced from PubChem (CID 91622627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).