4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid

C12H11N3O4 — CID 91622666

IUPAC4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid
SMILESO=C(O)CCC(=O)Nc1nnc(-c2ccccc2)o1
InChIInChI=1S/C12H11N3O4/c16-9(6-7-10(17)18)13-12-15-14-11(19-12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,17,18)(H,13,15,16)
InChIKeyFRYQDALSBPOJDN-UHFFFAOYSA-N
MW261.24 g/mol
LogP1.54
Rot. Bonds5

About 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid

4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid (PubChem CID 91622666) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid.

Molecular Properties

Compound Name4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid
PubChem CID91622666
Molecular FormulaC12H11N3O4
Molecular Weight261.24 g/mol
Exact Mass261.07
IUPAC Name4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid
SMILESO=C(O)CCC(=O)Nc1nnc(-c2ccccc2)o1
InChIInChI=1S/C12H11N3O4/c16-9(6-7-10(17)18)13-12-15-14-11(19-12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,17,18)(H,13,15,16)
InChIKeyFRYQDALSBPOJDN-UHFFFAOYSA-N
XLogP1.54
TPSA105.32 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.24
LogP ≤ 51.54
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid?
The IUPAC name of 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid (CID 91622666) is 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid.
What is the SMILES notation for 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid?
The canonical SMILES for 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid is O=C(O)CCC(=O)Nc1nnc(-c2ccccc2)o1.
What is the InChIKey of 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid?
The InChIKey is FRYQDALSBPOJDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O4/c16-9(6-7-10(17)18)13-12-15-14-11(19-12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,17,18)(H,13,15,16).
What are the key properties of 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid?
4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid has a molecular weight of 261.24 g/mol, XLogP of 1.54, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-4-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]butanoic acid is sourced from PubChem (CID 91622666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).