About (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione
(2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione (PubChem CID 91622674) has the molecular formula C8H15N3O4S
and a molecular weight of 249.29 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione.
Molecular Properties
| Compound Name | (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione |
| PubChem CID | 91622674 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione |
| SMILES | CC(C)(S)[C@@H](N)C(=O)O.O=C1CNC(=O)N1 |
| InChI | InChI=1S/C5H11NO2S.C3H4N2O2/c1-5(2,9)3(6)4(7)8;6-2-1-4-3(7)5-2/h3,9H,6H2,1-2H3,(H,7,8);1H2,(H2,4,5,6,7)/t3-;/m0./s1 |
| InChIKey | AKLAJQDNSVKUPG-DFWYDOINSA-N |
| XLogP | -1.07 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione?
The IUPAC name of (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione (CID 91622674) is (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione.
What is the SMILES notation for (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione?
The canonical SMILES for (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione is CC(C)(S)[C@@H](N)C(=O)O.O=C1CNC(=O)N1.
What is the InChIKey of (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione?
The InChIKey is AKLAJQDNSVKUPG-DFWYDOINSA-N. The full InChI is InChI=1S/C5H11NO2S.C3H4N2O2/c1-5(2,9)3(6)4(7)8;6-2-1-4-3(7)5-2/h3,9H,6H2,1-2H3,(H,7,8);1H2,(H2,4,5,6,7)/t3-;/m0./s1.
What are the key properties of (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione?
(2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione has a molecular weight of 249.29 g/mol, XLogP of -1.07, 2 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-methyl-3-sulfanylbutanoic acid;imidazolidine-2,4-dione is sourced from PubChem (CID 91622674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).