About 3,6-dimethyl-1-propylpyrimidine-2,4-dione
3,6-dimethyl-1-propylpyrimidine-2,4-dione (PubChem CID 91622846) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 3,6-dimethyl-1-propylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 3,6-dimethyl-1-propylpyrimidine-2,4-dione |
| PubChem CID | 91622846 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 3,6-dimethyl-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(C)cc(=O)n(C)c1=O |
| InChI | InChI=1S/C9H14N2O2/c1-4-5-11-7(2)6-8(12)10(3)9(11)13/h6H,4-5H2,1-3H3 |
| InChIKey | MWGBCTLNLAQVJE-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,6-dimethyl-1-propylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1-propylpyrimidine-2,4-dione?
The IUPAC name of 3,6-dimethyl-1-propylpyrimidine-2,4-dione (CID 91622846) is 3,6-dimethyl-1-propylpyrimidine-2,4-dione.
What is the SMILES notation for 3,6-dimethyl-1-propylpyrimidine-2,4-dione?
The canonical SMILES for 3,6-dimethyl-1-propylpyrimidine-2,4-dione is CCCn1c(C)cc(=O)n(C)c1=O.
What is the InChIKey of 3,6-dimethyl-1-propylpyrimidine-2,4-dione?
The InChIKey is MWGBCTLNLAQVJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-4-5-11-7(2)6-8(12)10(3)9(11)13/h6H,4-5H2,1-3H3.
What are the key properties of 3,6-dimethyl-1-propylpyrimidine-2,4-dione?
3,6-dimethyl-1-propylpyrimidine-2,4-dione has a molecular weight of 182.22 g/mol, XLogP of 0.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1-propylpyrimidine-2,4-dione is sourced from PubChem (CID 91622846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).