C18H21N3O5 — CID 91623333
5-amino-8-[2-(2-hydroxyethylamino)ethylamino]anthracene-1,4,9,10-tetrol (PubChem CID 91623333) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is 5-amino-8-[2-(2-hydroxyethylamino)ethylamino]anthracene-1,4,9,10-tetrol.
| Compound Name | 5-amino-8-[2-(2-hydroxyethylamino)ethylamino]anthracene-1,4,9,10-tetrol |
|---|---|
| PubChem CID | 91623333 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 5-amino-8-[2-(2-hydroxyethylamino)ethylamino]anthracene-1,4,9,10-tetrol |
| SMILES | Nc1ccc(NCCNCCO)c2c(O)c3c(O)ccc(O)c3c(O)c12 |
| InChI | InChI=1S/C18H21N3O5/c19-9-1-2-10(21-6-5-20-7-8-22)14-13(9)17(25)15-11(23)3-4-12(24)16(15)18(14)26/h1-4,20-26H,5-8,19H2 |
| InChIKey | MZHANDGFEYQOAY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|