C22H28N2O8 — CID 91623334
5,8-bis[2-(2-hydroxyethoxy)ethylamino]anthracene-1,4,9,10-tetrol (PubChem CID 91623334) has the molecular formula C22H28N2O8 and a molecular weight of 448.47 g/mol. Its IUPAC name is 5,8-bis[2-(2-hydroxyethoxy)ethylamino]anthracene-1,4,9,10-tetrol.
| Compound Name | 5,8-bis[2-(2-hydroxyethoxy)ethylamino]anthracene-1,4,9,10-tetrol |
|---|---|
| PubChem CID | 91623334 |
| Molecular Formula | C22H28N2O8 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 5,8-bis[2-(2-hydroxyethoxy)ethylamino]anthracene-1,4,9,10-tetrol |
| SMILES | OCCOCCNc1ccc(NCCOCCO)c2c(O)c3c(O)ccc(O)c3c(O)c12 |
| InChI | InChI=1S/C22H28N2O8/c25-7-11-31-9-5-23-13-1-2-14(24-6-10-32-12-8-26)18-17(13)21(29)19-15(27)3-4-16(28)20(19)22(18)30/h1-4,23-30H,5-12H2 |
| InChIKey | YAJHKKAGKXEULH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 163.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|