C18H22N4O4 — CID 91623335
5,8-bis(2-aminoethylamino)anthracene-1,4,9,10-tetrol (PubChem CID 91623335) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 5,8-bis(2-aminoethylamino)anthracene-1,4,9,10-tetrol.
| Compound Name | 5,8-bis(2-aminoethylamino)anthracene-1,4,9,10-tetrol |
|---|---|
| PubChem CID | 91623335 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 5,8-bis(2-aminoethylamino)anthracene-1,4,9,10-tetrol |
| SMILES | NCCNc1ccc(NCCN)c2c(O)c3c(O)ccc(O)c3c(O)c12 |
| InChI | InChI=1S/C18H22N4O4/c19-5-7-21-9-1-2-10(22-8-6-20)14-13(9)17(25)15-11(23)3-4-12(24)16(15)18(14)26/h1-4,21-26H,5-8,19-20H2 |
| InChIKey | OOGBXCBDTPMZAM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 157.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|