C11H17N3 — CID 91623618
N,N,6-trimethyl-1,2,3,4-tetrahydro-1,7-naphthyridin-8-amine (PubChem CID 91623618) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is N,N,6-trimethyl-1,2,3,4-tetrahydro-1,7-naphthyridin-8-amine.
| Compound Name | N,N,6-trimethyl-1,2,3,4-tetrahydro-1,7-naphthyridin-8-amine |
|---|---|
| PubChem CID | 91623618 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | N,N,6-trimethyl-1,2,3,4-tetrahydro-1,7-naphthyridin-8-amine |
| SMILES | Cc1cc2c(c(N(C)C)n1)NCCC2 |
| InChI | InChI=1S/C11H17N3/c1-8-7-9-5-4-6-12-10(9)11(13-8)14(2)3/h7,12H,4-6H2,1-3H3 |
| InChIKey | BLPVMHIDANEBGA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |