About 4-pyrrolidin-3-ylphenol;hydrobromide
4-pyrrolidin-3-ylphenol;hydrobromide (PubChem CID 91623789) has the molecular formula C10H14BrNO
and a molecular weight of 244.13 g/mol. Its IUPAC name is 4-pyrrolidin-3-ylphenol;hydrobromide.
Molecular Properties
| Compound Name | 4-pyrrolidin-3-ylphenol;hydrobromide |
| PubChem CID | 91623789 |
| Molecular Formula | C10H14BrNO |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 4-pyrrolidin-3-ylphenol;hydrobromide |
| SMILES | Br.Oc1ccc(C2CCNC2)cc1 |
| InChI | InChI=1S/C10H13NO.BrH/c12-10-3-1-8(2-4-10)9-5-6-11-7-9;/h1-4,9,11-12H,5-7H2;1H |
| InChIKey | SPKXTLWWFWSGLG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-pyrrolidin-3-ylphenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyrrolidin-3-ylphenol;hydrobromide?
The IUPAC name of 4-pyrrolidin-3-ylphenol;hydrobromide (CID 91623789) is 4-pyrrolidin-3-ylphenol;hydrobromide.
What is the SMILES notation for 4-pyrrolidin-3-ylphenol;hydrobromide?
The canonical SMILES for 4-pyrrolidin-3-ylphenol;hydrobromide is Br.Oc1ccc(C2CCNC2)cc1.
What is the InChIKey of 4-pyrrolidin-3-ylphenol;hydrobromide?
The InChIKey is SPKXTLWWFWSGLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.BrH/c12-10-3-1-8(2-4-10)9-5-6-11-7-9;/h1-4,9,11-12H,5-7H2;1H.
What are the key properties of 4-pyrrolidin-3-ylphenol;hydrobromide?
4-pyrrolidin-3-ylphenol;hydrobromide has a molecular weight of 244.13 g/mol, XLogP of 2.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyrrolidin-3-ylphenol;hydrobromide is sourced from PubChem (CID 91623789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).