C12H14FNO4 — CID 91623790
3-(3-fluorophenyl)pyrrolidine;oxalic acid (PubChem CID 91623790) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is 3-(3-fluorophenyl)pyrrolidine;oxalic acid.
| Compound Name | 3-(3-fluorophenyl)pyrrolidine;oxalic acid |
|---|---|
| PubChem CID | 91623790 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 3-(3-fluorophenyl)pyrrolidine;oxalic acid |
| SMILES | Fc1cccc(C2CCNC2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H12FN.C2H2O4/c11-10-3-1-2-8(6-10)9-4-5-12-7-9;3-1(4)2(5)6/h1-3,6,9,12H,4-5,7H2;(H,3,4)(H,5,6) |
| InChIKey | BASYITBKUYBBIP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|