C21H19NO2S — CID 91624538
N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-4-thiophen-3-ylbenzamide (PubChem CID 91624538) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-4-thiophen-3-ylbenzamide.
| Compound Name | N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-4-thiophen-3-ylbenzamide |
|---|---|
| PubChem CID | 91624538 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[(1-hydroxy-2,3-dihydroinden-1-yl)methyl]-4-thiophen-3-ylbenzamide |
| SMILES | O=C(NCC1(O)CCc2ccccc21)c1ccc(-c2ccsc2)cc1 |
| InChI | InChI=1S/C21H19NO2S/c23-20(17-7-5-15(6-8-17)18-10-12-25-13-18)22-14-21(24)11-9-16-3-1-2-4-19(16)21/h1-8,10,12-13,24H,9,11,14H2,(H,22,23) |
| InChIKey | BMWFIBSNCUUIDP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |