C10H9ClN4OS — CID 91625205
(5-chlorothiophen-2-yl)-[3-(triazol-1-yl)azetidin-1-yl]methanone (PubChem CID 91625205) has the molecular formula C10H9ClN4OS and a molecular weight of 268.73 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-[3-(triazol-1-yl)azetidin-1-yl]methanone.
| Compound Name | (5-chlorothiophen-2-yl)-[3-(triazol-1-yl)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 91625205 |
| Molecular Formula | C10H9ClN4OS |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | (5-chlorothiophen-2-yl)-[3-(triazol-1-yl)azetidin-1-yl]methanone |
| SMILES | O=C(c1ccc(Cl)s1)N1CC(n2ccnn2)C1 |
| InChI | InChI=1S/C10H9ClN4OS/c11-9-2-1-8(17-9)10(16)14-5-7(6-14)15-4-3-12-13-15/h1-4,7H,5-6H2 |
| InChIKey | NHVPEDSEZVQTLY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |