C15H20N2O2S — CID 91625371
N-cyclopentyl-6-(thiolan-3-yloxy)pyridine-3-carboxamide (PubChem CID 91625371) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is N-cyclopentyl-6-(thiolan-3-yloxy)pyridine-3-carboxamide.
| Compound Name | N-cyclopentyl-6-(thiolan-3-yloxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91625371 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-cyclopentyl-6-(thiolan-3-yloxy)pyridine-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccc(OC2CCSC2)nc1 |
| InChI | InChI=1S/C15H20N2O2S/c18-15(17-12-3-1-2-4-12)11-5-6-14(16-9-11)19-13-7-8-20-10-13/h5-6,9,12-13H,1-4,7-8,10H2,(H,17,18) |
| InChIKey | RQFGVXRQZNYYHZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |