C22H24N4O — CID 9162740
[4-[(2-methylphenyl)methyl]piperazin-1-yl]-(1-phenylpyrazol-4-yl)methanone (PubChem CID 9162740) has the molecular formula C22H24N4O and a molecular weight of 360.46 g/mol. Its IUPAC name is [4-[(2-methylphenyl)methyl]piperazin-1-yl]-(1-phenylpyrazol-4-yl)methanone.
| Compound Name | [4-[(2-methylphenyl)methyl]piperazin-1-yl]-(1-phenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 9162740 |
| Molecular Formula | C22H24N4O |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | [4-[(2-methylphenyl)methyl]piperazin-1-yl]-(1-phenylpyrazol-4-yl)methanone |
| SMILES | Cc1ccccc1CN1CCN(C(=O)c2cnn(-c3ccccc3)c2)CC1 |
| InChI | InChI=1S/C22H24N4O/c1-18-7-5-6-8-19(18)16-24-11-13-25(14-12-24)22(27)20-15-23-26(17-20)21-9-3-2-4-10-21/h2-10,15,17H,11-14,16H2,1H3 |
| InChIKey | TWOLWGVMPGXGQO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |