C18H23N5O3 — CID 91628240
3-[3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carbonyl]-1-methylpyridin-2-one (PubChem CID 91628240) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 3-[3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carbonyl]-1-methylpyridin-2-one.
| Compound Name | 3-[3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carbonyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 91628240 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 3-[3-[3-(dimethylamino)pyrazin-2-yl]oxypiperidine-1-carbonyl]-1-methylpyridin-2-one |
| SMILES | CN(C)c1nccnc1OC1CCCN(C(=O)c2cccn(C)c2=O)C1 |
| InChI | InChI=1S/C18H23N5O3/c1-21(2)15-16(20-9-8-19-15)26-13-6-4-11-23(12-13)18(25)14-7-5-10-22(3)17(14)24/h5,7-10,13H,4,6,11-12H2,1-3H3 |
| InChIKey | DXNSCNCKPBGKNV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |