About 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide
6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide (PubChem CID 91628643) has the molecular formula C12H15F3N4O
and a molecular weight of 288.27 g/mol. Its IUPAC name is 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide.
Molecular Properties
| Compound Name | 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide |
| PubChem CID | 91628643 |
| Molecular Formula | C12H15F3N4O |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCC(F)(F)F)c1cc(N2CCCCC2)ncn1 |
| InChI | InChI=1S/C12H15F3N4O/c13-12(14,15)7-16-11(20)9-6-10(18-8-17-9)19-4-2-1-3-5-19/h6,8H,1-5,7H2,(H,16,20) |
| InChIKey | GLJOLGIQUFWPGM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide?
The IUPAC name of 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide (CID 91628643) is 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide.
What is the SMILES notation for 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide?
The canonical SMILES for 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide is O=C(NCC(F)(F)F)c1cc(N2CCCCC2)ncn1.
What is the InChIKey of 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide?
The InChIKey is GLJOLGIQUFWPGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F3N4O/c13-12(14,15)7-16-11(20)9-6-10(18-8-17-9)19-4-2-1-3-5-19/h6,8H,1-5,7H2,(H,16,20).
What are the key properties of 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide?
6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide has a molecular weight of 288.27 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperidin-1-yl-N-(2,2,2-trifluoroethyl)pyrimidine-4-carboxamide is sourced from PubChem (CID 91628643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).