C24H20ClN3O2 — CID 9162963
2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[3-(hydroxymethyl)phenyl]acetamide (PubChem CID 9162963) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[3-(hydroxymethyl)phenyl]acetamide.
| Compound Name | 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[3-(hydroxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9162963 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]-N-[3-(hydroxymethyl)phenyl]acetamide |
| SMILES | O=C(Cc1cn(-c2ccccc2)nc1-c1ccc(Cl)cc1)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C24H20ClN3O2/c25-20-11-9-18(10-12-20)24-19(15-28(27-24)22-7-2-1-3-8-22)14-23(30)26-21-6-4-5-17(13-21)16-29/h1-13,15,29H,14,16H2,(H,26,30) |
| InChIKey | YILAYJZBRZSEGZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |