C18H14ClF3N2O3 — CID 91632332
N-[2-(7-chloro-3-oxo-5H-1,4-benzoxazepin-4-yl)ethyl]-2,3,4-trifluorobenzamide (PubChem CID 91632332) has the molecular formula C18H14ClF3N2O3 and a molecular weight of 398.77 g/mol. Its IUPAC name is N-[2-(7-chloro-3-oxo-5H-1,4-benzoxazepin-4-yl)ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-(7-chloro-3-oxo-5H-1,4-benzoxazepin-4-yl)ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 91632332 |
| Molecular Formula | C18H14ClF3N2O3 |
| Molecular Weight | 398.77 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | N-[2-(7-chloro-3-oxo-5H-1,4-benzoxazepin-4-yl)ethyl]-2,3,4-trifluorobenzamide |
| SMILES | O=C(NCCN1Cc2cc(Cl)ccc2OCC1=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H14ClF3N2O3/c19-11-1-4-14-10(7-11)8-24(15(25)9-27-14)6-5-23-18(26)12-2-3-13(20)17(22)16(12)21/h1-4,7H,5-6,8-9H2,(H,23,26) |
| InChIKey | RILQCPVFMRHMKK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|