C17H14FN3O5S2 — CID 91632611
methyl 3-[(13-fluoro-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-5-yl)sulfonyl]thiophene-2-carboxylate (PubChem CID 91632611) has the molecular formula C17H14FN3O5S2 and a molecular weight of 423.45 g/mol. Its IUPAC name is methyl 3-[(13-fluoro-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-5-yl)sulfonyl]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(13-fluoro-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-5-yl)sulfonyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 91632611 |
| Molecular Formula | C17H14FN3O5S2 |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | methyl 3-[(13-fluoro-2-oxo-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-5-yl)sulfonyl]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1S(=O)(=O)N1CCc2nc3ccc(F)cn3c(=O)c2C1 |
| InChI | InChI=1S/C17H14FN3O5S2/c1-26-17(23)15-13(5-7-27-15)28(24,25)20-6-4-12-11(9-20)16(22)21-8-10(18)2-3-14(21)19-12/h2-3,5,7-8H,4,6,9H2,1H3 |
| InChIKey | NXKFDOFFXZHARP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |