About [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate
[2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate (PubChem CID 91635904) has the molecular formula C21H14N2O4S
and a molecular weight of 390.42 g/mol. Its IUPAC name is [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate.
Molecular Properties
| Compound Name | [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate |
| PubChem CID | 91635904 |
| Molecular Formula | C21H14N2O4S |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate |
| SMILES | Cc1ccc2nc(-c3ccccc3OS(=O)(=O)c3ccccc3C#N)oc2c1 |
| InChI | InChI=1S/C21H14N2O4S/c1-14-10-11-17-19(12-14)26-21(23-17)16-7-3-4-8-18(16)27-28(24,25)20-9-5-2-6-15(20)13-22/h2-12H,1H3 |
| InChIKey | MDIRDRKUCMTWQN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate?
The IUPAC name of [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate (CID 91635904) is [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate.
What is the SMILES notation for [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate?
The canonical SMILES for [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate is Cc1ccc2nc(-c3ccccc3OS(=O)(=O)c3ccccc3C#N)oc2c1.
What is the InChIKey of [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate?
The InChIKey is MDIRDRKUCMTWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14N2O4S/c1-14-10-11-17-19(12-14)26-21(23-17)16-7-3-4-8-18(16)27-28(24,25)20-9-5-2-6-15(20)13-22/h2-12H,1H3.
What are the key properties of [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate?
[2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate has a molecular weight of 390.42 g/mol, XLogP of 4.44, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(6-methyl-1,3-benzoxazol-2-yl)phenyl] 2-cyanobenzenesulfonate is sourced from PubChem (CID 91635904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).