C11H18N2O — CID 91636373
1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole (PubChem CID 91636373) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole.
| Compound Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole |
|---|---|
| PubChem CID | 91636373 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole |
| SMILES | CC1(C)CC(n2cccn2)C(C)(C)O1 |
| InChI | InChI=1S/C11H18N2O/c1-10(2)8-9(11(3,4)14-10)13-7-5-6-12-13/h5-7,9H,8H2,1-4H3 |
| InChIKey | OJOYIFJAHKTWEL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |