C23H20O5 — CID 91636536
10-(2H-chromen-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione (PubChem CID 91636536) has the molecular formula C23H20O5 and a molecular weight of 376.41 g/mol. Its IUPAC name is 10-(2H-chromen-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione.
| Compound Name | 10-(2H-chromen-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 91636536 |
| Molecular Formula | C23H20O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 10-(2H-chromen-3-yl)-2,2-dimethyl-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione |
| SMILES | CC1(C)CC(=O)c2ccc3c(c2O1)C(C1=Cc2ccccc2OC1)CC(=O)O3 |
| InChI | InChI=1S/C23H20O5/c1-23(2)11-17(24)15-7-8-19-21(22(15)28-23)16(10-20(25)27-19)14-9-13-5-3-4-6-18(13)26-12-14/h3-9,16H,10-12H2,1-2H3 |
| InChIKey | CDDMSNLEDWCGSL-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|