C20H29N3OS2 — CID 91636794
5-(dithiolan-3-yl)-N-[(1S)-2-methyl-1-(1-methylbenzimidazol-2-yl)propyl]pentanamide (PubChem CID 91636794) has the molecular formula C20H29N3OS2 and a molecular weight of 391.61 g/mol. Its IUPAC name is 5-(dithiolan-3-yl)-N-[(1S)-2-methyl-1-(1-methylbenzimidazol-2-yl)propyl]pentanamide.
| Compound Name | 5-(dithiolan-3-yl)-N-[(1S)-2-methyl-1-(1-methylbenzimidazol-2-yl)propyl]pentanamide |
|---|---|
| PubChem CID | 91636794 |
| Molecular Formula | C20H29N3OS2 |
| Molecular Weight | 391.61 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 5-(dithiolan-3-yl)-N-[(1S)-2-methyl-1-(1-methylbenzimidazol-2-yl)propyl]pentanamide |
| SMILES | CC(C)[C@H](NC(=O)CCCCC1CCSS1)c1nc2ccccc2n1C |
| InChI | InChI=1S/C20H29N3OS2/c1-14(2)19(20-21-16-9-5-6-10-17(16)23(20)3)22-18(24)11-7-4-8-15-12-13-25-26-15/h5-6,9-10,14-15,19H,4,7-8,11-13H2,1-3H3,(H,22,24)/t15?,19-/m0/s1 |
| InChIKey | AMFGVCMUYZFOQQ-FUBQLUNQSA-N |
| XLogP | 5.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|