C24H22N2O4S — CID 91637604
3-hydroxy-6-methyl-2-[3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-thiophen-3-ylpropyl]pyran-4-one (PubChem CID 91637604) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 3-hydroxy-6-methyl-2-[3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-thiophen-3-ylpropyl]pyran-4-one.
| Compound Name | 3-hydroxy-6-methyl-2-[3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-thiophen-3-ylpropyl]pyran-4-one |
|---|---|
| PubChem CID | 91637604 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 3-hydroxy-6-methyl-2-[3-oxo-3-(1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-1-thiophen-3-ylpropyl]pyran-4-one |
| SMILES | Cc1cc(=O)c(O)c(C(CC(=O)N2CCc3c([nH]c4ccccc34)C2)c2ccsc2)o1 |
| InChI | InChI=1S/C24H22N2O4S/c1-14-10-21(27)23(29)24(30-14)18(15-7-9-31-13-15)11-22(28)26-8-6-17-16-4-2-3-5-19(16)25-20(17)12-26/h2-5,7,9-10,13,18,25,29H,6,8,11-12H2,1H3 |
| InChIKey | HRMZAQQBCGCPQS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|