C13H14O4 — CID 91637670
8-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 91637670) has the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. Its IUPAC name is 8-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | 8-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 91637670 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 8-propan-2-yl-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | CC(C)C1CC(=O)Oc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C13H14O4/c1-7(2)8-4-13(14)17-10-5-12-11(3-9(8)10)15-6-16-12/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | JMZBKLGEKCSVGF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|