C28H34N2O7 — CID 91637720
methyl 3-[3-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methyl]-5-oxo-1,2-dihydropyrazol-4-yl]-3-(2,3,4-trimethoxyphenyl)propanoate (PubChem CID 91637720) has the molecular formula C28H34N2O7 and a molecular weight of 510.59 g/mol. Its IUPAC name is methyl 3-[3-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methyl]-5-oxo-1,2-dihydropyrazol-4-yl]-3-(2,3,4-trimethoxyphenyl)propanoate.
| Compound Name | methyl 3-[3-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methyl]-5-oxo-1,2-dihydropyrazol-4-yl]-3-(2,3,4-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 91637720 |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | methyl 3-[3-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)methyl]-5-oxo-1,2-dihydropyrazol-4-yl]-3-(2,3,4-trimethoxyphenyl)propanoate |
| SMILES | COC(=O)CC(c1ccc(OC)c(OC)c1OC)c1c(Cc2ccc3c(c2)CCC(C)(C)O3)[nH][nH]c1=O |
| InChI | InChI=1S/C28H34N2O7/c1-28(2)12-11-17-13-16(7-9-21(17)37-28)14-20-24(27(32)30-29-20)19(15-23(31)34-4)18-8-10-22(33-3)26(36-6)25(18)35-5/h7-10,13,19H,11-12,14-15H2,1-6H3,(H2,29,30,32) |
| InChIKey | PRVIRWMDBDYODR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |