C24H22O9 — CID 91637784
6-acetyl-5-hydroxy-4-methyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-2,8-dione (PubChem CID 91637784) has the molecular formula C24H22O9 and a molecular weight of 454.43 g/mol. Its IUPAC name is 6-acetyl-5-hydroxy-4-methyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-2,8-dione.
| Compound Name | 6-acetyl-5-hydroxy-4-methyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-2,8-dione |
|---|---|
| PubChem CID | 91637784 |
| Molecular Formula | C24H22O9 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 6-acetyl-5-hydroxy-4-methyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydropyrano[2,3-h]chromene-2,8-dione |
| SMILES | COc1cc(OC)c(C2CC(=O)Oc3c(C(C)=O)c(O)c4c(C)cc(=O)oc4c32)cc1OC |
| InChI | InChI=1S/C24H22O9/c1-10-6-17(26)32-23-19(10)22(28)20(11(2)25)24-21(23)13(8-18(27)33-24)12-7-15(30-4)16(31-5)9-14(12)29-3/h6-7,9,13,28H,8H2,1-5H3 |
| InChIKey | GITVKERNERUSQC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|