C27H17NO6 — CID 91637789
5-hydroxy-2-(4-hydroxyphenyl)-10-quinolin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 91637789) has the molecular formula C27H17NO6 and a molecular weight of 451.43 g/mol. Its IUPAC name is 5-hydroxy-2-(4-hydroxyphenyl)-10-quinolin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | 5-hydroxy-2-(4-hydroxyphenyl)-10-quinolin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 91637789 |
| Molecular Formula | C27H17NO6 |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-10-quinolin-4-yl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | O=C1CC(c2ccnc3ccccc23)c2c(cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc23)O1 |
| InChI | InChI=1S/C27H17NO6/c29-15-7-5-14(6-8-15)22-12-20(30)26-21(31)13-23-25(27(26)34-22)18(11-24(32)33-23)16-9-10-28-19-4-2-1-3-17(16)19/h1-10,12-13,18,29,31H,11H2 |
| InChIKey | LFLLWNKHEJRQIR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|