C25H19NO8 — CID 91638048
methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)propanoate (PubChem CID 91638048) has the molecular formula C25H19NO8 and a molecular weight of 461.43 g/mol. Its IUPAC name is methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)propanoate.
| Compound Name | methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)propanoate |
|---|---|
| PubChem CID | 91638048 |
| Molecular Formula | C25H19NO8 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | methyl 3-(1-hydroxy-3,4-dioxonaphthalen-2-yl)-3-(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)propanoate |
| SMILES | COC(=O)CC(C1=C(O)c2ccccc2C(=O)C1=O)c1cc2cc3c(cc2[nH]c1=O)OCCO3 |
| InChI | InChI=1S/C25H19NO8/c1-32-20(27)10-15(21-22(28)13-4-2-3-5-14(13)23(29)24(21)30)16-8-12-9-18-19(34-7-6-33-18)11-17(12)26-25(16)31/h2-5,8-9,11,15,28H,6-7,10H2,1H3,(H,26,31) |
| InChIKey | HDPOCWIGTWAHJE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 131.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|