C23H24O7 — CID 91638157
2,2-dimethyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione (PubChem CID 91638157) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is 2,2-dimethyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione.
| Compound Name | 2,2-dimethyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione |
|---|---|
| PubChem CID | 91638157 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2,2-dimethyl-10-(2,4,5-trimethoxyphenyl)-9,10-dihydro-3H-pyrano[2,3-f]chromene-4,8-dione |
| SMILES | COc1cc(OC)c(C2CC(=O)Oc3ccc4c(c32)OC(C)(C)CC4=O)cc1OC |
| InChI | InChI=1S/C23H24O7/c1-23(2)11-15(24)12-6-7-16-21(22(12)30-23)14(9-20(25)29-16)13-8-18(27-4)19(28-5)10-17(13)26-3/h6-8,10,14H,9,11H2,1-5H3 |
| InChIKey | CGSPGZNATUTXNE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|