C14H10O5 — CID 91638443
8-(furan-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one (PubChem CID 91638443) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is 8-(furan-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one.
| Compound Name | 8-(furan-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
|---|---|
| PubChem CID | 91638443 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 8-(furan-2-yl)-7,8-dihydro-[1,3]dioxolo[4,5-g]chromen-6-one |
| SMILES | O=C1CC(c2ccco2)c2cc3c(cc2O1)OCO3 |
| InChI | InChI=1S/C14H10O5/c15-14-5-9(10-2-1-3-16-10)8-4-12-13(18-7-17-12)6-11(8)19-14/h1-4,6,9H,5,7H2 |
| InChIKey | HRSWRKCLMQWMAZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|