C22H29N5O2S — CID 91638703
(1S,9R)-11-[2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanylbutanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 91638703) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is (1S,9R)-11-[2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanylbutanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9R)-11-[2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanylbutanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 91638703 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | (1S,9R)-11-[2-[(4,6-dimethylpyrimidin-2-yl)amino]-4-methylsulfanylbutanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CSCCC(Nc1nc(C)cc(C)n1)C(=O)N1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C22H29N5O2S/c1-14-9-15(2)24-22(23-14)25-18(7-8-30-3)21(29)26-11-16-10-17(13-26)19-5-4-6-20(28)27(19)12-16/h4-6,9,16-18H,7-8,10-13H2,1-3H3,(H,23,24,25)/t16-,17+,18?/m1/s1 |
| InChIKey | PHWAKMMQCNVRPB-DVKDBIPTSA-N |
| XLogP | 2.43 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |