C17H16N4O2 — CID 9163904
N',N'-dimethyl-4-oxo-3-phenylphthalazine-1-carbohydrazide (PubChem CID 9163904) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is N',N'-dimethyl-4-oxo-3-phenylphthalazine-1-carbohydrazide.
| Compound Name | N',N'-dimethyl-4-oxo-3-phenylphthalazine-1-carbohydrazide |
|---|---|
| PubChem CID | 9163904 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | N',N'-dimethyl-4-oxo-3-phenylphthalazine-1-carbohydrazide |
| SMILES | CN(C)NC(=O)c1nn(-c2ccccc2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C17H16N4O2/c1-20(2)19-16(22)15-13-10-6-7-11-14(13)17(23)21(18-15)12-8-4-3-5-9-12/h3-11H,1-2H3,(H,19,22) |
| InChIKey | QCHOJAVQTKZINP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|