C22H29N5O2 — CID 91639625
2-(4-pyrrol-1-yloxan-4-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide (PubChem CID 91639625) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-(4-pyrrol-1-yloxan-4-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide.
| Compound Name | 2-(4-pyrrol-1-yloxan-4-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide |
|---|---|
| PubChem CID | 91639625 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-(4-pyrrol-1-yloxan-4-yl)-N-[5-([1,2,4]triazolo[4,3-a]pyridin-3-yl)pentyl]acetamide |
| SMILES | O=C(CC1(n2cccc2)CCOCC1)NCCCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C22H29N5O2/c28-21(18-22(10-16-29-17-11-22)26-13-6-7-14-26)23-12-4-1-2-8-19-24-25-20-9-3-5-15-27(19)20/h3,5-7,9,13-15H,1-2,4,8,10-12,16-18H2,(H,23,28) |
| InChIKey | OGYVERGRIOKUMK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 73.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|