C16H22N2O3S — CID 91639880
N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide (PubChem CID 91639880) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide.
| Compound Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 91639880 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-5-oxo-1-phenylpyrrolidine-3-carboxamide |
| SMILES | CSCCC(CO)NC(=O)C1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C16H22N2O3S/c1-22-8-7-13(11-19)17-16(21)12-9-15(20)18(10-12)14-5-3-2-4-6-14/h2-6,12-13,19H,7-11H2,1H3,(H,17,21) |
| InChIKey | SPRNRTQZRMBKGI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |