About 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid
2-(3-chloro-1,2,4-triazol-1-yl)acetic acid (PubChem CID 91640997) has the molecular formula C4H4ClN3O2
and a molecular weight of 161.55 g/mol. Its IUPAC name is 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid |
| PubChem CID | 91640997 |
| Molecular Formula | C4H4ClN3O2 |
| Molecular Weight | 161.55 g/mol |
| Exact Mass | 161.00 |
| IUPAC Name | 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid |
| SMILES | O=C(O)Cn1cnc(Cl)n1 |
| InChI | InChI=1S/C4H4ClN3O2/c5-4-6-2-8(7-4)1-3(9)10/h2H,1H2,(H,9,10) |
| InChIKey | XSFLDYOEYMCYCL-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.55 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid?
The IUPAC name of 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid (CID 91640997) is 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid.
What is the SMILES notation for 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid?
The canonical SMILES for 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid is O=C(O)Cn1cnc(Cl)n1.
What is the InChIKey of 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid?
The InChIKey is XSFLDYOEYMCYCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4ClN3O2/c5-4-6-2-8(7-4)1-3(9)10/h2H,1H2,(H,9,10).
What are the key properties of 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid?
2-(3-chloro-1,2,4-triazol-1-yl)acetic acid has a molecular weight of 161.55 g/mol, XLogP of 0.02, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-1,2,4-triazol-1-yl)acetic acid is sourced from PubChem (CID 91640997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).