About 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol
3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol (PubChem CID 91641325) has the molecular formula C5H8BrN3O
and a molecular weight of 206.04 g/mol. Its IUPAC name is 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol |
| PubChem CID | 91641325 |
| Molecular Formula | C5H8BrN3O |
| Molecular Weight | 206.04 g/mol |
| Exact Mass | 204.99 |
| IUPAC Name | 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol |
| SMILES | OCCCn1cnc(Br)n1 |
| InChI | InChI=1S/C5H8BrN3O/c6-5-7-4-9(8-5)2-1-3-10/h4,10H,1-3H2 |
| InChIKey | KCQPWNAMDBIWAG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.04 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol?
The IUPAC name of 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol (CID 91641325) is 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol.
What is the SMILES notation for 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol?
The canonical SMILES for 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol is OCCCn1cnc(Br)n1.
What is the InChIKey of 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol?
The InChIKey is KCQPWNAMDBIWAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrN3O/c6-5-7-4-9(8-5)2-1-3-10/h4,10H,1-3H2.
What are the key properties of 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol?
3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol has a molecular weight of 206.04 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromo-1,2,4-triazol-1-yl)propan-1-ol is sourced from PubChem (CID 91641325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).