C17H20OS — CID 91641452
1-methyl-2-(3-phenylpropylsulfinylmethyl)benzene (PubChem CID 91641452) has the molecular formula C17H20OS and a molecular weight of 272.41 g/mol. Its IUPAC name is 1-methyl-2-(3-phenylpropylsulfinylmethyl)benzene.
| Compound Name | 1-methyl-2-(3-phenylpropylsulfinylmethyl)benzene |
|---|---|
| PubChem CID | 91641452 |
| Molecular Formula | C17H20OS |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 1-methyl-2-(3-phenylpropylsulfinylmethyl)benzene |
| SMILES | Cc1ccccc1CS(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C17H20OS/c1-15-8-5-6-12-17(15)14-19(18)13-7-11-16-9-3-2-4-10-16/h2-6,8-10,12H,7,11,13-14H2,1H3 |
| InChIKey | RIECMOSGTKCIGN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |