C16H24N2O5 — CID 91641777
[2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate (PubChem CID 91641777) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is [2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate.
| Compound Name | [2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 91641777 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | [2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 2-nitrocyclopropane-1-carboxylate |
| SMILES | CC1CCN(C(=O)COC(=O)C2CC2[N+](=O)[O-])C2CCCCC12 |
| InChI | InChI=1S/C16H24N2O5/c1-10-6-7-17(13-5-3-2-4-11(10)13)15(19)9-23-16(20)12-8-14(12)18(21)22/h10-14H,2-9H2,1H3 |
| InChIKey | CUHULBFRFMWBLB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|