About 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine
9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine (PubChem CID 91642522) has the molecular formula C16H23N7S
and a molecular weight of 345.48 g/mol. Its IUPAC name is 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine.
Molecular Properties
| Compound Name | 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine |
| PubChem CID | 91642522 |
| Molecular Formula | C16H23N7S |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine |
| SMILES | CCc1ncc(CN(C)Cn2cnc3c(NC(C)C)ncnc32)s1 |
| InChI | InChI=1S/C16H23N7S/c1-5-13-17-6-12(24-13)7-22(4)10-23-9-20-14-15(21-11(2)3)18-8-19-16(14)23/h6,8-9,11H,5,7,10H2,1-4H3,(H,18,19,21) |
| InChIKey | ZXLBGOHXRLMGAF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine?
The IUPAC name of 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine (CID 91642522) is 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine.
What is the SMILES notation for 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine?
The canonical SMILES for 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine is CCc1ncc(CN(C)Cn2cnc3c(NC(C)C)ncnc32)s1.
What is the InChIKey of 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine?
The InChIKey is ZXLBGOHXRLMGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N7S/c1-5-13-17-6-12(24-13)7-22(4)10-23-9-20-14-15(21-11(2)3)18-8-19-16(14)23/h6,8-9,11H,5,7,10H2,1-4H3,(H,18,19,21).
What are the key properties of 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine?
9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine has a molecular weight of 345.48 g/mol, XLogP of 2.76, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[[(2-ethyl-1,3-thiazol-5-yl)methyl-methylamino]methyl]-N-propan-2-ylpurin-6-amine is sourced from PubChem (CID 91642522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).